C16H23NO2 — CID 98077087
methyl (2R)-2-[[(1R,2S)-2-methylcyclohexyl]amino]-2-phenylacetate (PubChem CID 98077087) has the molecular formula C16H23NO2 and a molecular weight of 261.37 g/mol. Its IUPAC name is methyl (2R)-2-[[(1R,2S)-2-methylcyclohexyl]amino]-2-phenylacetate.
| Compound Name | methyl (2R)-2-[[(1R,2S)-2-methylcyclohexyl]amino]-2-phenylacetate |
|---|---|
| PubChem CID | 98077087 |
| Molecular Formula | C16H23NO2 |
| Molecular Weight | 261.37 g/mol |
| Exact Mass | 261.17 |
| IUPAC Name | methyl (2R)-2-[[(1R,2S)-2-methylcyclohexyl]amino]-2-phenylacetate |
| SMILES | COC(=O)[C@H](N[C@@H]1CCCC[C@@H]1C)c1ccccc1 |
| InChI | InChI=1S/C16H23NO2/c1-12-8-6-7-11-14(12)17-15(16(18)19-2)13-9-4-3-5-10-13/h3-5,9-10,12,14-15,17H,6-8,11H2,1-2H3/t12-,14+,15+/m0/s1 |
| InChIKey | RCVKYUZFFIUVAG-NWANDNLSSA-N |
| XLogP | 3.07 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.37 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |