C17H17NO2 — CID 97180818
N-[[(2S)-oxiran-2-yl]methyl]-2,2-diphenylacetamide (PubChem CID 97180818) has the molecular formula C17H17NO2 and a molecular weight of 267.33 g/mol. Its IUPAC name is N-[[(2S)-oxiran-2-yl]methyl]-2,2-diphenylacetamide.
| Compound Name | N-[[(2S)-oxiran-2-yl]methyl]-2,2-diphenylacetamide |
|---|---|
| PubChem CID | 97180818 |
| Molecular Formula | C17H17NO2 |
| Molecular Weight | 267.33 g/mol |
| Exact Mass | 267.13 |
| IUPAC Name | N-[[(2S)-oxiran-2-yl]methyl]-2,2-diphenylacetamide |
| SMILES | O=C(NC[C@H]1CO1)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C17H17NO2/c19-17(18-11-15-12-20-15)16(13-7-3-1-4-8-13)14-9-5-2-6-10-14/h1-10,15-16H,11-12H2,(H,18,19)/t15-/m0/s1 |
| InChIKey | ODJKPRGTLUPGCK-HNNXBMFYSA-N |
| XLogP | 2.33 |
| TPSA | 41.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.33 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|