C18H28N2O3 — CID 143881582
2-acetamido-3,3-dimethyl-N-(oxiran-2-ylmethyl)butanamide;toluene (PubChem CID 143881582) has the molecular formula C18H28N2O3 and a molecular weight of 320.43 g/mol. Its IUPAC name is 2-acetamido-3,3-dimethyl-N-(oxiran-2-ylmethyl)butanamide;toluene.
| Compound Name | 2-acetamido-3,3-dimethyl-N-(oxiran-2-ylmethyl)butanamide;toluene |
|---|---|
| PubChem CID | 143881582 |
| Molecular Formula | C18H28N2O3 |
| Molecular Weight | 320.43 g/mol |
| Exact Mass | 320.21 |
| IUPAC Name | 2-acetamido-3,3-dimethyl-N-(oxiran-2-ylmethyl)butanamide;toluene |
| SMILES | CC(=O)NC(C(=O)NCC1CO1)C(C)(C)C.Cc1ccccc1 |
| InChI | InChI=1S/C11H20N2O3.C7H8/c1-7(14)13-9(11(2,3)4)10(15)12-5-8-6-16-8;1-7-5-3-2-4-6-7/h8-9H,5-6H2,1-4H3,(H,12,15)(H,13,14);2-6H,1H3 |
| InChIKey | CWFCTLTVSSVVIS-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 70.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.43 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|