C11H13NO3 — CID 97180854
N-[[(2R)-oxiran-2-yl]methyl]-2-phenoxyacetamide (PubChem CID 97180854) has the molecular formula C11H13NO3 and a molecular weight of 207.23 g/mol. Its IUPAC name is N-[[(2R)-oxiran-2-yl]methyl]-2-phenoxyacetamide.
| Compound Name | N-[[(2R)-oxiran-2-yl]methyl]-2-phenoxyacetamide |
|---|---|
| PubChem CID | 97180854 |
| Molecular Formula | C11H13NO3 |
| Molecular Weight | 207.23 g/mol |
| Exact Mass | 207.09 |
| IUPAC Name | N-[[(2R)-oxiran-2-yl]methyl]-2-phenoxyacetamide |
| SMILES | O=C(COc1ccccc1)NC[C@@H]1CO1 |
| InChI | InChI=1S/C11H13NO3/c13-11(12-6-10-7-14-10)8-15-9-4-2-1-3-5-9/h1-5,10H,6-8H2,(H,12,13)/t10-/m1/s1 |
| InChIKey | QKNRKOKJNUBAGL-SNVBAGLBSA-N |
| XLogP | 0.58 |
| TPSA | 50.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.23 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|