C13H17NO3 — CID 97180614
2-(3,4-dimethylphenoxy)-N-[[(2R)-oxiran-2-yl]methyl]acetamide (PubChem CID 97180614) has the molecular formula C13H17NO3 and a molecular weight of 235.28 g/mol. Its IUPAC name is 2-(3,4-dimethylphenoxy)-N-[[(2R)-oxiran-2-yl]methyl]acetamide.
| Compound Name | 2-(3,4-dimethylphenoxy)-N-[[(2R)-oxiran-2-yl]methyl]acetamide |
|---|---|
| PubChem CID | 97180614 |
| Molecular Formula | C13H17NO3 |
| Molecular Weight | 235.28 g/mol |
| Exact Mass | 235.12 |
| IUPAC Name | 2-(3,4-dimethylphenoxy)-N-[[(2R)-oxiran-2-yl]methyl]acetamide |
| SMILES | Cc1ccc(OCC(=O)NC[C@@H]2CO2)cc1C |
| InChI | InChI=1S/C13H17NO3/c1-9-3-4-11(5-10(9)2)17-8-13(15)14-6-12-7-16-12/h3-5,12H,6-8H2,1-2H3,(H,14,15)/t12-/m1/s1 |
| InChIKey | HSDQVVDDHTUYJR-GFCCVEGCSA-N |
| XLogP | 1.20 |
| TPSA | 50.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.28 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|