C8H15NO2 — CID 71755387
2,2-dimethyl-N-[[(2R)-oxiran-2-yl]methyl]propanamide (PubChem CID 71755387) has the molecular formula C8H15NO2 and a molecular weight of 157.21 g/mol. Its IUPAC name is 2,2-dimethyl-N-[[(2R)-oxiran-2-yl]methyl]propanamide.
| Compound Name | 2,2-dimethyl-N-[[(2R)-oxiran-2-yl]methyl]propanamide |
|---|---|
| PubChem CID | 71755387 |
| Molecular Formula | C8H15NO2 |
| Molecular Weight | 157.21 g/mol |
| Exact Mass | 157.11 |
| IUPAC Name | 2,2-dimethyl-N-[[(2R)-oxiran-2-yl]methyl]propanamide |
| SMILES | CC(C)(C)C(=O)NC[C@@H]1CO1 |
| InChI | InChI=1S/C8H15NO2/c1-8(2,3)7(10)9-4-6-5-11-6/h6H,4-5H2,1-3H3,(H,9,10)/t6-/m1/s1 |
| InChIKey | BRFWAVIZIBIALS-ZCFIWIBFSA-N |
| XLogP | 0.55 |
| TPSA | 41.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.21 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|