C10H16N2O4 — CID 175178142
N,N'-bis(oxiran-2-ylmethyl)butanediamide (PubChem CID 175178142) has the molecular formula C10H16N2O4 and a molecular weight of 228.25 g/mol. Its IUPAC name is N,N'-bis(oxiran-2-ylmethyl)butanediamide.
| Compound Name | N,N'-bis(oxiran-2-ylmethyl)butanediamide |
|---|---|
| PubChem CID | 175178142 |
| Molecular Formula | C10H16N2O4 |
| Molecular Weight | 228.25 g/mol |
| Exact Mass | 228.11 |
| IUPAC Name | N,N'-bis(oxiran-2-ylmethyl)butanediamide |
| SMILES | O=C(CCC(=O)NCC1CO1)NCC1CO1 |
| InChI | InChI=1S/C10H16N2O4/c13-9(11-3-7-5-15-7)1-2-10(14)12-4-8-6-16-8/h7-8H,1-6H2,(H,11,13)(H,12,14) |
| InChIKey | ZOPHVABURXKUKT-UHFFFAOYSA-N |
| XLogP | -1.20 |
| TPSA | 83.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.25 |
| LogP ≤ 5 | -1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|