C10H18ClNO3 — CID 61023950
5-chloro-N-(1,4-dioxan-2-ylmethyl)pentanamide (PubChem CID 61023950) has the molecular formula C10H18ClNO3 and a molecular weight of 235.71 g/mol. Its IUPAC name is 5-chloro-N-(1,4-dioxan-2-ylmethyl)pentanamide.
| Compound Name | 5-chloro-N-(1,4-dioxan-2-ylmethyl)pentanamide |
|---|---|
| PubChem CID | 61023950 |
| Molecular Formula | C10H18ClNO3 |
| Molecular Weight | 235.71 g/mol |
| Exact Mass | 235.10 |
| IUPAC Name | 5-chloro-N-(1,4-dioxan-2-ylmethyl)pentanamide |
| SMILES | O=C(CCCCCl)NCC1COCCO1 |
| InChI | InChI=1S/C10H18ClNO3/c11-4-2-1-3-10(13)12-7-9-8-14-5-6-15-9/h9H,1-8H2,(H,12,13) |
| InChIKey | KPZXYQJSBAWIFE-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.71 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|