C12H22NO5S2- — CID 58922130
N-(1,4,7,10,13-pentaoxacyclopentadec-2-ylmethyl)carbamodithioate (PubChem CID 58922130) has the molecular formula C12H22NO5S2- and a molecular weight of 324.44 g/mol. Its IUPAC name is N-(1,4,7,10,13-pentaoxacyclopentadec-2-ylmethyl)carbamodithioate.
| Compound Name | N-(1,4,7,10,13-pentaoxacyclopentadec-2-ylmethyl)carbamodithioate |
|---|---|
| PubChem CID | 58922130 |
| Molecular Formula | C12H22NO5S2- |
| Molecular Weight | 324.44 g/mol |
| Exact Mass | 324.09 |
| IUPAC Name | N-(1,4,7,10,13-pentaoxacyclopentadec-2-ylmethyl)carbamodithioate |
| SMILES | S=C([S-])NCC1COCCOCCOCCOCCO1 |
| InChI | InChI=1S/C12H23NO5S2/c19-12(20)13-9-11-10-17-6-5-15-2-1-14-3-4-16-7-8-18-11/h11H,1-10H2,(H2,13,19,20)/p-1 |
| InChIKey | SQFKOQFIGUOHQL-UHFFFAOYSA-M |
| XLogP | -0.13 |
| TPSA | 58.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.44 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|