C6H13N3O2S — CID 61023162
1-amino-3-(1,4-dioxan-2-ylmethyl)thiourea (PubChem CID 61023162) has the molecular formula C6H13N3O2S and a molecular weight of 191.26 g/mol. Its IUPAC name is 1-amino-3-(1,4-dioxan-2-ylmethyl)thiourea.
| Compound Name | 1-amino-3-(1,4-dioxan-2-ylmethyl)thiourea |
|---|---|
| PubChem CID | 61023162 |
| Molecular Formula | C6H13N3O2S |
| Molecular Weight | 191.26 g/mol |
| Exact Mass | 191.07 |
| IUPAC Name | 1-amino-3-(1,4-dioxan-2-ylmethyl)thiourea |
| SMILES | NNC(=S)NCC1COCCO1 |
| InChI | InChI=1S/C6H13N3O2S/c7-9-6(12)8-3-5-4-10-1-2-11-5/h5H,1-4,7H2,(H2,8,9,12) |
| InChIKey | QJPTZTHSIJNGNT-UHFFFAOYSA-N |
| XLogP | -1.26 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.26 |
| LogP ≤ 5 | -1.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|