C10H17NO5 — CID 61023561
5-(1,4-dioxan-2-ylmethylamino)-5-oxopentanoic acid (PubChem CID 61023561) has the molecular formula C10H17NO5 and a molecular weight of 231.25 g/mol. Its IUPAC name is 5-(1,4-dioxan-2-ylmethylamino)-5-oxopentanoic acid.
| Compound Name | 5-(1,4-dioxan-2-ylmethylamino)-5-oxopentanoic acid |
|---|---|
| PubChem CID | 61023561 |
| Molecular Formula | C10H17NO5 |
| Molecular Weight | 231.25 g/mol |
| Exact Mass | 231.11 |
| IUPAC Name | 5-(1,4-dioxan-2-ylmethylamino)-5-oxopentanoic acid |
| SMILES | O=C(O)CCCC(=O)NCC1COCCO1 |
| InChI | InChI=1S/C10H17NO5/c12-9(2-1-3-10(13)14)11-6-8-7-15-4-5-16-8/h8H,1-7H2,(H,11,12)(H,13,14) |
| InChIKey | HXGXEAAXVOWFSQ-UHFFFAOYSA-N |
| XLogP | -0.23 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.25 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |