C7H13N3O4 — CID 61023976
N-(1,4-dioxan-2-ylmethyl)-2-hydrazinyl-2-oxoacetamide (PubChem CID 61023976) has the molecular formula C7H13N3O4 and a molecular weight of 203.20 g/mol. Its IUPAC name is N-(1,4-dioxan-2-ylmethyl)-2-hydrazinyl-2-oxoacetamide.
| Compound Name | N-(1,4-dioxan-2-ylmethyl)-2-hydrazinyl-2-oxoacetamide |
|---|---|
| PubChem CID | 61023976 |
| Molecular Formula | C7H13N3O4 |
| Molecular Weight | 203.20 g/mol |
| Exact Mass | 203.09 |
| IUPAC Name | N-(1,4-dioxan-2-ylmethyl)-2-hydrazinyl-2-oxoacetamide |
| SMILES | NNC(=O)C(=O)NCC1COCCO1 |
| InChI | InChI=1S/C7H13N3O4/c8-10-7(12)6(11)9-3-5-4-13-1-2-14-5/h5H,1-4,8H2,(H,9,11)(H,10,12) |
| InChIKey | OGJOGTFSICJWOA-UHFFFAOYSA-N |
| XLogP | -2.49 |
| TPSA | 102.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.20 |
| LogP ≤ 5 | -2.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|