C12H23NO5S2 — CID 58922113
1,4,7,10,13-pentaoxacyclopentadec-2-ylmethylcarbamodithioic acid (PubChem CID 58922113) has the molecular formula C12H23NO5S2 and a molecular weight of 325.45 g/mol. Its IUPAC name is 1,4,7,10,13-pentaoxacyclopentadec-2-ylmethylcarbamodithioic acid.
| Compound Name | 1,4,7,10,13-pentaoxacyclopentadec-2-ylmethylcarbamodithioic acid |
|---|---|
| PubChem CID | 58922113 |
| Molecular Formula | C12H23NO5S2 |
| Molecular Weight | 325.45 g/mol |
| Exact Mass | 325.10 |
| IUPAC Name | 1,4,7,10,13-pentaoxacyclopentadec-2-ylmethylcarbamodithioic acid |
| SMILES | S=C(S)NCC1COCCOCCOCCOCCO1 |
| InChI | InChI=1S/C12H23NO5S2/c19-12(20)13-9-11-10-17-6-5-15-2-1-14-3-4-16-7-8-18-11/h11H,1-10H2,(H2,13,19,20) |
| InChIKey | SQFKOQFIGUOHQL-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 58.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.45 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|