C10H15N3O2 — CID 102548376
3-(1-methylpyrazol-4-yl)-N-(oxiran-2-ylmethyl)propanamide (PubChem CID 102548376) has the molecular formula C10H15N3O2 and a molecular weight of 209.25 g/mol. Its IUPAC name is 3-(1-methylpyrazol-4-yl)-N-(oxiran-2-ylmethyl)propanamide.
| Compound Name | 3-(1-methylpyrazol-4-yl)-N-(oxiran-2-ylmethyl)propanamide |
|---|---|
| PubChem CID | 102548376 |
| Molecular Formula | C10H15N3O2 |
| Molecular Weight | 209.25 g/mol |
| Exact Mass | 209.12 |
| IUPAC Name | 3-(1-methylpyrazol-4-yl)-N-(oxiran-2-ylmethyl)propanamide |
| SMILES | Cn1cc(CCC(=O)NCC2CO2)cn1 |
| InChI | InChI=1S/C10H15N3O2/c1-13-6-8(4-12-13)2-3-10(14)11-5-9-7-15-9/h4,6,9H,2-3,5,7H2,1H3,(H,11,14) |
| InChIKey | ADELGKIDPWGCAH-UHFFFAOYSA-N |
| XLogP | -0.13 |
| TPSA | 59.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.25 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|