C12H19N3O3 — CID 119234671
5-[3-(1-methylpyrazol-4-yl)propanoylamino]pentanoic acid (PubChem CID 119234671) has the molecular formula C12H19N3O3 and a molecular weight of 253.30 g/mol. Its IUPAC name is 5-[3-(1-methylpyrazol-4-yl)propanoylamino]pentanoic acid.
| Compound Name | 5-[3-(1-methylpyrazol-4-yl)propanoylamino]pentanoic acid |
|---|---|
| PubChem CID | 119234671 |
| Molecular Formula | C12H19N3O3 |
| Molecular Weight | 253.30 g/mol |
| Exact Mass | 253.14 |
| IUPAC Name | 5-[3-(1-methylpyrazol-4-yl)propanoylamino]pentanoic acid |
| SMILES | Cn1cc(CCC(=O)NCCCCC(=O)O)cn1 |
| InChI | InChI=1S/C12H19N3O3/c1-15-9-10(8-14-15)5-6-11(16)13-7-3-2-4-12(17)18/h8-9H,2-7H2,1H3,(H,13,16)(H,17,18) |
| InChIKey | IIEHMNXUXNGLNV-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.30 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|