C12H23NO2 — CID 141190006
2,2-dimethyl-N-[[(3R,4S)-3-methyloxan-4-yl]methyl]propanamide (PubChem CID 141190006) has the molecular formula C12H23NO2 and a molecular weight of 213.32 g/mol. Its IUPAC name is 2,2-dimethyl-N-[[(3R,4S)-3-methyloxan-4-yl]methyl]propanamide.
| Compound Name | 2,2-dimethyl-N-[[(3R,4S)-3-methyloxan-4-yl]methyl]propanamide |
|---|---|
| PubChem CID | 141190006 |
| Molecular Formula | C12H23NO2 |
| Molecular Weight | 213.32 g/mol |
| Exact Mass | 213.17 |
| IUPAC Name | 2,2-dimethyl-N-[[(3R,4S)-3-methyloxan-4-yl]methyl]propanamide |
| SMILES | C[C@H]1COCC[C@@H]1CNC(=O)C(C)(C)C |
| InChI | InChI=1S/C12H23NO2/c1-9-8-15-6-5-10(9)7-13-11(14)12(2,3)4/h9-10H,5-8H2,1-4H3,(H,13,14)/t9-,10+/m0/s1 |
| InChIKey | FTRBLOSXSCGYKN-VHSXEESVSA-N |
| XLogP | 1.82 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.32 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |