About 2,2-dimethyl-N-[[(3R,4S)-3-methyloxan-4-yl]methyl]propanamide
2,2-dimethyl-N-[[(3R,4S)-3-methyloxan-4-yl]methyl]propanamide (PubChem CID 141190006) has the molecular formula C12H23NO2
and a molecular weight of 213.32 g/mol. Its IUPAC name is 2,2-dimethyl-N-[[(3R,4S)-3-methyloxan-4-yl]methyl]propanamide.
Molecular Properties
| Compound Name | 2,2-dimethyl-N-[[(3R,4S)-3-methyloxan-4-yl]methyl]propanamide |
| PubChem CID | 141190006 |
| Molecular Formula | C12H23NO2 |
| Molecular Weight | 213.32 g/mol |
| Exact Mass | 213.17 |
| IUPAC Name | 2,2-dimethyl-N-[[(3R,4S)-3-methyloxan-4-yl]methyl]propanamide |
| SMILES | C[C@H]1COCC[C@@H]1CNC(=O)C(C)(C)C |
| InChI | InChI=1S/C12H23NO2/c1-9-8-15-6-5-10(9)7-13-11(14)12(2,3)4/h9-10H,5-8H2,1-4H3,(H,13,14)/t9-,10+/m0/s1 |
| InChIKey | FTRBLOSXSCGYKN-VHSXEESVSA-N |
| XLogP | 1.82 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.32 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2,2-dimethyl-N-[[(3R,4S)-3-methyloxan-4-yl]methyl]propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-dimethyl-N-[[(3R,4S)-3-methyloxan-4-yl]methyl]propanamide?
The IUPAC name of 2,2-dimethyl-N-[[(3R,4S)-3-methyloxan-4-yl]methyl]propanamide (CID 141190006) is 2,2-dimethyl-N-[[(3R,4S)-3-methyloxan-4-yl]methyl]propanamide.
What is the SMILES notation for 2,2-dimethyl-N-[[(3R,4S)-3-methyloxan-4-yl]methyl]propanamide?
The canonical SMILES for 2,2-dimethyl-N-[[(3R,4S)-3-methyloxan-4-yl]methyl]propanamide is C[C@H]1COCC[C@@H]1CNC(=O)C(C)(C)C.
What is the InChIKey of 2,2-dimethyl-N-[[(3R,4S)-3-methyloxan-4-yl]methyl]propanamide?
The InChIKey is FTRBLOSXSCGYKN-VHSXEESVSA-N. The full InChI is InChI=1S/C12H23NO2/c1-9-8-15-6-5-10(9)7-13-11(14)12(2,3)4/h9-10H,5-8H2,1-4H3,(H,13,14)/t9-,10+/m0/s1.
What are the key properties of 2,2-dimethyl-N-[[(3R,4S)-3-methyloxan-4-yl]methyl]propanamide?
2,2-dimethyl-N-[[(3R,4S)-3-methyloxan-4-yl]methyl]propanamide has a molecular weight of 213.32 g/mol, XLogP of 1.82, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-dimethyl-N-[[(3R,4S)-3-methyloxan-4-yl]methyl]propanamide is sourced from PubChem (CID 141190006), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).