C20H23NO2 — CID 140784136
4-[1-(dimethylamino)ethyl]-3,3-diphenyloxolan-2-one (PubChem CID 140784136) has the molecular formula C20H23NO2 and a molecular weight of 309.41 g/mol. Its IUPAC name is 4-[1-(dimethylamino)ethyl]-3,3-diphenyloxolan-2-one.
| Compound Name | 4-[1-(dimethylamino)ethyl]-3,3-diphenyloxolan-2-one |
|---|---|
| PubChem CID | 140784136 |
| Molecular Formula | C20H23NO2 |
| Molecular Weight | 309.41 g/mol |
| Exact Mass | 309.17 |
| IUPAC Name | 4-[1-(dimethylamino)ethyl]-3,3-diphenyloxolan-2-one |
| SMILES | CC(C1COC(=O)C1(c1ccccc1)c1ccccc1)N(C)C |
| InChI | InChI=1S/C20H23NO2/c1-15(21(2)3)18-14-23-19(22)20(18,16-10-6-4-7-11-16)17-12-8-5-9-13-17/h4-13,15,18H,14H2,1-3H3 |
| InChIKey | KIJNHTWFMCXCND-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.41 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |