C19H18ClNO2 — CID 89315616
1-(3-chloropropyl)-3,3-diphenylpyrrolidine-2,5-dione (PubChem CID 89315616) has the molecular formula C19H18ClNO2 and a molecular weight of 327.81 g/mol. Its IUPAC name is 1-(3-chloropropyl)-3,3-diphenylpyrrolidine-2,5-dione.
| Compound Name | 1-(3-chloropropyl)-3,3-diphenylpyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 89315616 |
| Molecular Formula | C19H18ClNO2 |
| Molecular Weight | 327.81 g/mol |
| Exact Mass | 327.10 |
| IUPAC Name | 1-(3-chloropropyl)-3,3-diphenylpyrrolidine-2,5-dione |
| SMILES | O=C1CC(c2ccccc2)(c2ccccc2)C(=O)N1CCCCl |
| InChI | InChI=1S/C19H18ClNO2/c20-12-7-13-21-17(22)14-19(18(21)23,15-8-3-1-4-9-15)16-10-5-2-6-11-16/h1-6,8-11H,7,12-14H2 |
| InChIKey | FMEQZECJRBBCDN-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.81 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|