C18H14N2O3 — CID 101472182
(3R)-1'-benzylspiro[1H-indole-3,3'-pyrrolidine]-2,2',5'-trione (PubChem CID 101472182) has the molecular formula C18H14N2O3 and a molecular weight of 306.32 g/mol. Its IUPAC name is (3R)-1'-benzylspiro[1H-indole-3,3'-pyrrolidine]-2,2',5'-trione.
| Compound Name | (3R)-1'-benzylspiro[1H-indole-3,3'-pyrrolidine]-2,2',5'-trione |
|---|---|
| PubChem CID | 101472182 |
| Molecular Formula | C18H14N2O3 |
| Molecular Weight | 306.32 g/mol |
| Exact Mass | 306.10 |
| IUPAC Name | (3R)-1'-benzylspiro[1H-indole-3,3'-pyrrolidine]-2,2',5'-trione |
| SMILES | O=C1C[C@@]2(C(=O)Nc3ccccc32)C(=O)N1Cc1ccccc1 |
| InChI | InChI=1S/C18H14N2O3/c21-15-10-18(13-8-4-5-9-14(13)19-16(18)22)17(23)20(15)11-12-6-2-1-3-7-12/h1-9H,10-11H2,(H,19,22)/t18-/m1/s1 |
| InChIKey | WPYZVGRGAHWPPO-GOSISDBHSA-N |
| XLogP | 1.84 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.32 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|