C17H16N2OS — CID 24714506
1'-benzylspiro[1,3-thiazolidine-2,3'-indole]-2'-one (PubChem CID 24714506) has the molecular formula C17H16N2OS and a molecular weight of 296.39 g/mol. Its IUPAC name is 1'-benzylspiro[1,3-thiazolidine-2,3'-indole]-2'-one.
| Compound Name | 1'-benzylspiro[1,3-thiazolidine-2,3'-indole]-2'-one |
|---|---|
| PubChem CID | 24714506 |
| Molecular Formula | C17H16N2OS |
| Molecular Weight | 296.39 g/mol |
| Exact Mass | 296.10 |
| IUPAC Name | 1'-benzylspiro[1,3-thiazolidine-2,3'-indole]-2'-one |
| SMILES | O=C1N(Cc2ccccc2)c2ccccc2C12NCCS2 |
| InChI | InChI=1S/C17H16N2OS/c20-16-17(18-10-11-21-17)14-8-4-5-9-15(14)19(16)12-13-6-2-1-3-7-13/h1-9,18H,10-12H2 |
| InChIKey | QOHDBKFYNSBLEU-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.39 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |