C22H16ClN3OS — CID 71291276
1'-[(3-chlorophenyl)methyl]-5-phenylspiro[3H-1,3,4-thiadiazole-2,3'-indole]-2'-one (PubChem CID 71291276) has the molecular formula C22H16ClN3OS and a molecular weight of 405.91 g/mol. Its IUPAC name is 1'-[(3-chlorophenyl)methyl]-5-phenylspiro[3H-1,3,4-thiadiazole-2,3'-indole]-2'-one.
| Compound Name | 1'-[(3-chlorophenyl)methyl]-5-phenylspiro[3H-1,3,4-thiadiazole-2,3'-indole]-2'-one |
|---|---|
| PubChem CID | 71291276 |
| Molecular Formula | C22H16ClN3OS |
| Molecular Weight | 405.91 g/mol |
| Exact Mass | 405.07 |
| IUPAC Name | 1'-[(3-chlorophenyl)methyl]-5-phenylspiro[3H-1,3,4-thiadiazole-2,3'-indole]-2'-one |
| SMILES | O=C1N(Cc2cccc(Cl)c2)c2ccccc2C12NN=C(c1ccccc1)S2 |
| InChI | InChI=1S/C22H16ClN3OS/c23-17-10-6-7-15(13-17)14-26-19-12-5-4-11-18(19)22(21(26)27)25-24-20(28-22)16-8-2-1-3-9-16/h1-13,25H,14H2 |
| InChIKey | MDYKPRSVHPKBQR-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.91 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het_thio_5_B(2)', 'substructure': 'N/A'} |
|---|