About CID 102218446
CID 102218446 (PubChem CID 102218446) has the molecular formula C27H24N2O2S2
and a molecular weight of 472.64 g/mol.
Molecular Properties
| Compound Name | CID 102218446 |
| PubChem CID | 102218446 |
| Molecular Formula | C27H24N2O2S2 |
| Molecular Weight | 472.64 g/mol |
| Exact Mass | 472.13 |
| IUPAC Name | — |
| SMILES | CN1C(=O)[C@]2(SCCCS[C@]23C(=O)N(Cc2ccccc2)c2ccccc23)c2ccccc21 |
| InChI | InChI=1S/C27H24N2O2S2/c1-28-22-14-7-5-12-20(22)26(24(28)30)27(33-17-9-16-32-26)21-13-6-8-15-23(21)29(25(27)31)18-19-10-3-2-4-11-19/h2-8,10-15H,9,16-18H2,1H3/t26-,27-/m1/s1 |
| InChIKey | LJSHMMINVAAQGQ-KAYWLYCHSA-N |
| XLogP | 5.17 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 472.64 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze CID 102218446 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 102218446?
The IUPAC name of CID 102218446 (CID 102218446) is not available.
What is the SMILES notation for CID 102218446?
The canonical SMILES for CID 102218446 is CN1C(=O)[C@]2(SCCCS[C@]23C(=O)N(Cc2ccccc2)c2ccccc23)c2ccccc21.
What is the InChIKey of CID 102218446?
The InChIKey is LJSHMMINVAAQGQ-KAYWLYCHSA-N. The full InChI is InChI=1S/C27H24N2O2S2/c1-28-22-14-7-5-12-20(22)26(24(28)30)27(33-17-9-16-32-26)21-13-6-8-15-23(21)29(25(27)31)18-19-10-3-2-4-11-19/h2-8,10-15H,9,16-18H2,1H3/t26-,27-/m1/s1.
What are the key properties of CID 102218446?
CID 102218446 has a molecular weight of 472.64 g/mol, XLogP of 5.17, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 102218446 is sourced from PubChem (CID 102218446), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).