C27H20N2O4 — CID 102130135
CID 102130135 (PubChem CID 102130135) has the molecular formula C27H20N2O4 and a molecular weight of 436.47 g/mol.
| Compound Name | CID 102130135 |
|---|---|
| PubChem CID | 102130135 |
| Molecular Formula | C27H20N2O4 |
| Molecular Weight | 436.47 g/mol |
| Exact Mass | 436.14 |
| IUPAC Name | — |
| SMILES | CN1C(=O)C2(C(C=O)=COC23C(=O)N(Cc2ccccc2)c2ccccc23)c2ccccc21 |
| InChI | InChI=1S/C27H20N2O4/c1-28-22-13-7-5-11-20(22)26(24(28)31)19(16-30)17-33-27(26)21-12-6-8-14-23(21)29(25(27)32)15-18-9-3-2-4-10-18/h2-14,16-17H,15H2,1H3 |
| InChIKey | YMOHCDVDMQLKKM-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.47 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|