C28H24N2O5 — CID 11465522
7'-[(3S)-1-benzyl-3-[(E)-2-methoxyethenyl]-2-oxoindol-3-yl]spiro[1,3-dioxolane-2,3'-1H-indole]-2'-one (PubChem CID 11465522) has the molecular formula C28H24N2O5 and a molecular weight of 468.51 g/mol. Its IUPAC name is 7'-[(3S)-1-benzyl-3-[(E)-2-methoxyethenyl]-2-oxoindol-3-yl]spiro[1,3-dioxolane-2,3'-1H-indole]-2'-one.
| Compound Name | 7'-[(3S)-1-benzyl-3-[(E)-2-methoxyethenyl]-2-oxoindol-3-yl]spiro[1,3-dioxolane-2,3'-1H-indole]-2'-one |
|---|---|
| PubChem CID | 11465522 |
| Molecular Formula | C28H24N2O5 |
| Molecular Weight | 468.51 g/mol |
| Exact Mass | 468.17 |
| IUPAC Name | 7'-[(3S)-1-benzyl-3-[(E)-2-methoxyethenyl]-2-oxoindol-3-yl]spiro[1,3-dioxolane-2,3'-1H-indole]-2'-one |
| SMILES | CO/C=C/[C@@]1(c2cccc3c2NC(=O)C32OCCO2)C(=O)N(Cc2ccccc2)c2ccccc21 |
| InChI | InChI=1S/C28H24N2O5/c1-33-15-14-27(21-11-7-12-22-24(21)29-25(31)28(22)34-16-17-35-28)20-10-5-6-13-23(20)30(26(27)32)18-19-8-3-2-4-9-19/h2-15H,16-18H2,1H3,(H,29,31)/b15-14+/t27-/m1/s1 |
| InChIKey | DDDFNQGWPDBBKW-BTUVCSFDSA-N |
| XLogP | 3.83 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.51 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|