C27H26ClN3O2 — CID 71531907
1-[[4-(4-chlorophenyl)piperazin-1-yl]methyl]-3,3-diphenylpyrrolidine-2,5-dione (PubChem CID 71531907) has the molecular formula C27H26ClN3O2 and a molecular weight of 459.98 g/mol. Its IUPAC name is 1-[[4-(4-chlorophenyl)piperazin-1-yl]methyl]-3,3-diphenylpyrrolidine-2,5-dione.
| Compound Name | 1-[[4-(4-chlorophenyl)piperazin-1-yl]methyl]-3,3-diphenylpyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 71531907 |
| Molecular Formula | C27H26ClN3O2 |
| Molecular Weight | 459.98 g/mol |
| Exact Mass | 459.17 |
| IUPAC Name | 1-[[4-(4-chlorophenyl)piperazin-1-yl]methyl]-3,3-diphenylpyrrolidine-2,5-dione |
| SMILES | O=C1CC(c2ccccc2)(c2ccccc2)C(=O)N1CN1CCN(c2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C27H26ClN3O2/c28-23-11-13-24(14-12-23)30-17-15-29(16-18-30)20-31-25(32)19-27(26(31)33,21-7-3-1-4-8-21)22-9-5-2-6-10-22/h1-14H,15-20H2 |
| InChIKey | WLJJKQPBNJSAST-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.98 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|