C27H24FN3O2 — CID 3644671
1'-[[4-(4-fluorophenyl)piperazin-1-yl]methyl]spiro[fluorene-9,3'-pyrrolidine]-2',5'-dione (PubChem CID 3644671) has the molecular formula C27H24FN3O2 and a molecular weight of 441.51 g/mol. Its IUPAC name is 1'-[[4-(4-fluorophenyl)piperazin-1-yl]methyl]spiro[fluorene-9,3'-pyrrolidine]-2',5'-dione.
| Compound Name | 1'-[[4-(4-fluorophenyl)piperazin-1-yl]methyl]spiro[fluorene-9,3'-pyrrolidine]-2',5'-dione |
|---|---|
| PubChem CID | 3644671 |
| Molecular Formula | C27H24FN3O2 |
| Molecular Weight | 441.51 g/mol |
| Exact Mass | 441.19 |
| IUPAC Name | 1'-[[4-(4-fluorophenyl)piperazin-1-yl]methyl]spiro[fluorene-9,3'-pyrrolidine]-2',5'-dione |
| SMILES | O=C1CC2(C(=O)N1CN1CCN(c3ccc(F)cc3)CC1)c1ccccc1-c1ccccc12 |
| InChI | InChI=1S/C27H24FN3O2/c28-19-9-11-20(12-10-19)30-15-13-29(14-16-30)18-31-25(32)17-27(26(31)33)23-7-3-1-5-21(23)22-6-2-4-8-24(22)27/h1-12H,13-18H2 |
| InChIKey | CHNPABOQKWZLBN-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.51 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|