C19H17BrFN3O2 — CID 3658866
5-bromo-1-[[4-(4-fluorophenyl)piperazin-1-yl]methyl]indole-2,3-dione (PubChem CID 3658866) has the molecular formula C19H17BrFN3O2 and a molecular weight of 418.27 g/mol. Its IUPAC name is 5-bromo-1-[[4-(4-fluorophenyl)piperazin-1-yl]methyl]indole-2,3-dione.
| Compound Name | 5-bromo-1-[[4-(4-fluorophenyl)piperazin-1-yl]methyl]indole-2,3-dione |
|---|---|
| PubChem CID | 3658866 |
| Molecular Formula | C19H17BrFN3O2 |
| Molecular Weight | 418.27 g/mol |
| Exact Mass | 417.05 |
| IUPAC Name | 5-bromo-1-[[4-(4-fluorophenyl)piperazin-1-yl]methyl]indole-2,3-dione |
| SMILES | O=C1C(=O)N(CN2CCN(c3ccc(F)cc3)CC2)c2ccc(Br)cc21 |
| InChI | InChI=1S/C19H17BrFN3O2/c20-13-1-6-17-16(11-13)18(25)19(26)24(17)12-22-7-9-23(10-8-22)15-4-2-14(21)3-5-15/h1-6,11H,7-10,12H2 |
| InChIKey | AFQBAFLPSMXEGX-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.27 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|