C28H29BrN4O3 — CID 4006529
5-bromo-3-(4-ethoxyphenyl)imino-1-[[4-(4-methoxyphenyl)piperazin-1-yl]methyl]indol-2-one (PubChem CID 4006529) has the molecular formula C28H29BrN4O3 and a molecular weight of 549.47 g/mol. Its IUPAC name is 5-bromo-3-(4-ethoxyphenyl)imino-1-[[4-(4-methoxyphenyl)piperazin-1-yl]methyl]indol-2-one.
| Compound Name | 5-bromo-3-(4-ethoxyphenyl)imino-1-[[4-(4-methoxyphenyl)piperazin-1-yl]methyl]indol-2-one |
|---|---|
| PubChem CID | 4006529 |
| Molecular Formula | C28H29BrN4O3 |
| Molecular Weight | 549.47 g/mol |
| Exact Mass | 548.14 |
| IUPAC Name | 5-bromo-3-(4-ethoxyphenyl)imino-1-[[4-(4-methoxyphenyl)piperazin-1-yl]methyl]indol-2-one |
| SMILES | CCOc1ccc(/N=C2\C(=O)N(CN3CCN(c4ccc(OC)cc4)CC3)c3ccc(Br)cc32)cc1 |
| InChI | InChI=1S/C28H29BrN4O3/c1-3-36-24-9-5-21(6-10-24)30-27-25-18-20(29)4-13-26(25)33(28(27)34)19-31-14-16-32(17-15-31)22-7-11-23(35-2)12-8-22/h4-13,18H,3,14-17,19H2,1-2H3/b30-27- |
| InChIKey | KLMTYCSATKLJQX-IKPAITLHSA-N |
| XLogP | 5.10 |
| TPSA | 57.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.47 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|