C23H26N4O5S — CID 3283445
5-morpholin-4-ylsulfonyl-1-[(4-phenylpiperazin-1-yl)methyl]indole-2,3-dione (PubChem CID 3283445) has the molecular formula C23H26N4O5S and a molecular weight of 470.55 g/mol. Its IUPAC name is 5-morpholin-4-ylsulfonyl-1-[(4-phenylpiperazin-1-yl)methyl]indole-2,3-dione.
| Compound Name | 5-morpholin-4-ylsulfonyl-1-[(4-phenylpiperazin-1-yl)methyl]indole-2,3-dione |
|---|---|
| PubChem CID | 3283445 |
| Molecular Formula | C23H26N4O5S |
| Molecular Weight | 470.55 g/mol |
| Exact Mass | 470.16 |
| IUPAC Name | 5-morpholin-4-ylsulfonyl-1-[(4-phenylpiperazin-1-yl)methyl]indole-2,3-dione |
| SMILES | O=C1C(=O)N(CN2CCN(c3ccccc3)CC2)c2ccc(S(=O)(=O)N3CCOCC3)cc21 |
| InChI | InChI=1S/C23H26N4O5S/c28-22-20-16-19(33(30,31)26-12-14-32-15-13-26)6-7-21(20)27(23(22)29)17-24-8-10-25(11-9-24)18-4-2-1-3-5-18/h1-7,16H,8-15,17H2 |
| InChIKey | VXMXOIQJAFCBQP-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 90.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.55 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|