C22H23N3O5S — CID 4559425
1-(3,4-dihydro-1H-isoquinolin-2-ylmethyl)-5-morpholin-4-ylsulfonylindole-2,3-dione (PubChem CID 4559425) has the molecular formula C22H23N3O5S and a molecular weight of 441.51 g/mol. Its IUPAC name is 1-(3,4-dihydro-1H-isoquinolin-2-ylmethyl)-5-morpholin-4-ylsulfonylindole-2,3-dione.
| Compound Name | 1-(3,4-dihydro-1H-isoquinolin-2-ylmethyl)-5-morpholin-4-ylsulfonylindole-2,3-dione |
|---|---|
| PubChem CID | 4559425 |
| Molecular Formula | C22H23N3O5S |
| Molecular Weight | 441.51 g/mol |
| Exact Mass | 441.14 |
| IUPAC Name | 1-(3,4-dihydro-1H-isoquinolin-2-ylmethyl)-5-morpholin-4-ylsulfonylindole-2,3-dione |
| SMILES | O=C1C(=O)N(CN2CCc3ccccc3C2)c2ccc(S(=O)(=O)N3CCOCC3)cc21 |
| InChI | InChI=1S/C22H23N3O5S/c26-21-19-13-18(31(28,29)24-9-11-30-12-10-24)5-6-20(19)25(22(21)27)15-23-8-7-16-3-1-2-4-17(16)14-23/h1-6,13H,7-12,14-15H2 |
| InChIKey | LCRHDJBXKJZWJJ-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 87.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.51 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|