C22H25N5O5S — CID 4574907
5-morpholin-4-ylsulfonyl-1-[(4-pyridin-2-ylpiperazin-1-yl)methyl]indole-2,3-dione (PubChem CID 4574907) has the molecular formula C22H25N5O5S and a molecular weight of 471.54 g/mol. Its IUPAC name is 5-morpholin-4-ylsulfonyl-1-[(4-pyridin-2-ylpiperazin-1-yl)methyl]indole-2,3-dione.
| Compound Name | 5-morpholin-4-ylsulfonyl-1-[(4-pyridin-2-ylpiperazin-1-yl)methyl]indole-2,3-dione |
|---|---|
| PubChem CID | 4574907 |
| Molecular Formula | C22H25N5O5S |
| Molecular Weight | 471.54 g/mol |
| Exact Mass | 471.16 |
| IUPAC Name | 5-morpholin-4-ylsulfonyl-1-[(4-pyridin-2-ylpiperazin-1-yl)methyl]indole-2,3-dione |
| SMILES | O=C1C(=O)N(CN2CCN(c3ccccn3)CC2)c2ccc(S(=O)(=O)N3CCOCC3)cc21 |
| InChI | InChI=1S/C22H25N5O5S/c28-21-18-15-17(33(30,31)26-11-13-32-14-12-26)4-5-19(18)27(22(21)29)16-24-7-9-25(10-8-24)20-3-1-2-6-23-20/h1-6,15H,7-14,16H2 |
| InChIKey | RILFZUUJQPLLAH-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 103.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.54 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|