C19H23N3O3S2 — CID 9183743
1-(3,4-dihydro-1H-isoquinolin-2-ylmethyl)-5-morpholin-4-ylsulfonylpyridine-2-thione (PubChem CID 9183743) has the molecular formula C19H23N3O3S2 and a molecular weight of 405.55 g/mol. Its IUPAC name is 1-(3,4-dihydro-1H-isoquinolin-2-ylmethyl)-5-morpholin-4-ylsulfonylpyridine-2-thione.
| Compound Name | 1-(3,4-dihydro-1H-isoquinolin-2-ylmethyl)-5-morpholin-4-ylsulfonylpyridine-2-thione |
|---|---|
| PubChem CID | 9183743 |
| Molecular Formula | C19H23N3O3S2 |
| Molecular Weight | 405.55 g/mol |
| Exact Mass | 405.12 |
| IUPAC Name | 1-(3,4-dihydro-1H-isoquinolin-2-ylmethyl)-5-morpholin-4-ylsulfonylpyridine-2-thione |
| SMILES | O=S(=O)(c1ccc(=S)n(CN2CCc3ccccc3C2)c1)N1CCOCC1 |
| InChI | InChI=1S/C19H23N3O3S2/c23-27(24,22-9-11-25-12-10-22)18-5-6-19(26)21(14-18)15-20-8-7-16-3-1-2-4-17(16)13-20/h1-6,14H,7-13,15H2 |
| InChIKey | FSLDPWOSUBFQTN-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 54.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.55 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|