C14H22N3O3S2+ — CID 9193168
5-morpholin-4-ylsulfonyl-1-(pyrrolidin-1-ium-1-ylmethyl)pyridine-2-thione (PubChem CID 9193168) has the molecular formula C14H22N3O3S2+ and a molecular weight of 344.48 g/mol. Its IUPAC name is 5-morpholin-4-ylsulfonyl-1-(pyrrolidin-1-ium-1-ylmethyl)pyridine-2-thione.
| Compound Name | 5-morpholin-4-ylsulfonyl-1-(pyrrolidin-1-ium-1-ylmethyl)pyridine-2-thione |
|---|---|
| PubChem CID | 9193168 |
| Molecular Formula | C14H22N3O3S2+ |
| Molecular Weight | 344.48 g/mol |
| Exact Mass | 344.11 |
| IUPAC Name | 5-morpholin-4-ylsulfonyl-1-(pyrrolidin-1-ium-1-ylmethyl)pyridine-2-thione |
| SMILES | O=S(=O)(c1ccc(=S)n(C[NH+]2CCCC2)c1)N1CCOCC1 |
| InChI | InChI=1S/C14H21N3O3S2/c18-22(19,17-7-9-20-10-8-17)13-3-4-14(21)16(11-13)12-15-5-1-2-6-15/h3-4,11H,1-2,5-10,12H2/p+1 |
| InChIKey | ZPZUIYNNHCABDO-UHFFFAOYSA-O |
| XLogP | -0.13 |
| TPSA | 55.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.48 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|