C19H30N3O3S2+ — CID 11938491
1-[[(4aR,8aS)-1,2,3,4,4a,5,6,7,8,8a-decahydroquinolin-1-ium-1-yl]methyl]-5-morpholin-4-ylsulfonylpyridine-2-thione (PubChem CID 11938491) has the molecular formula C19H30N3O3S2+ and a molecular weight of 412.60 g/mol. Its IUPAC name is 1-[[(4aR,8aS)-1,2,3,4,4a,5,6,7,8,8a-decahydroquinolin-1-ium-1-yl]methyl]-5-morpholin-4-ylsulfonylpyridine-2-thione.
| Compound Name | 1-[[(4aR,8aS)-1,2,3,4,4a,5,6,7,8,8a-decahydroquinolin-1-ium-1-yl]methyl]-5-morpholin-4-ylsulfonylpyridine-2-thione |
|---|---|
| PubChem CID | 11938491 |
| Molecular Formula | C19H30N3O3S2+ |
| Molecular Weight | 412.60 g/mol |
| Exact Mass | 412.17 |
| IUPAC Name | 1-[[(4aR,8aS)-1,2,3,4,4a,5,6,7,8,8a-decahydroquinolin-1-ium-1-yl]methyl]-5-morpholin-4-ylsulfonylpyridine-2-thione |
| SMILES | O=S(=O)(c1ccc(=S)n(C[NH+]2CCC[C@H]3CCCC[C@@H]32)c1)N1CCOCC1 |
| InChI | InChI=1S/C19H29N3O3S2/c23-27(24,22-10-12-25-13-11-22)17-7-8-19(26)21(14-17)15-20-9-3-5-16-4-1-2-6-18(16)20/h7-8,14,16,18H,1-6,9-13,15H2/p+1/t16-,18+/m1/s1 |
| InChIKey | WLORFZOCIQPZDU-AEFFLSMTSA-O |
| XLogP | 1.43 |
| TPSA | 55.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.60 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|