C16H26N3O3S+ — CID 9193543
1-[(4-methylpiperidin-1-ium-1-yl)methyl]-5-pyrrolidin-1-ylsulfonylpyridin-2-one (PubChem CID 9193543) has the molecular formula C16H26N3O3S+ and a molecular weight of 340.47 g/mol. Its IUPAC name is 1-[(4-methylpiperidin-1-ium-1-yl)methyl]-5-pyrrolidin-1-ylsulfonylpyridin-2-one.
| Compound Name | 1-[(4-methylpiperidin-1-ium-1-yl)methyl]-5-pyrrolidin-1-ylsulfonylpyridin-2-one |
|---|---|
| PubChem CID | 9193543 |
| Molecular Formula | C16H26N3O3S+ |
| Molecular Weight | 340.47 g/mol |
| Exact Mass | 340.17 |
| IUPAC Name | 1-[(4-methylpiperidin-1-ium-1-yl)methyl]-5-pyrrolidin-1-ylsulfonylpyridin-2-one |
| SMILES | CC1CC[NH+](Cn2cc(S(=O)(=O)N3CCCC3)ccc2=O)CC1 |
| InChI | InChI=1S/C16H25N3O3S/c1-14-6-10-17(11-7-14)13-18-12-15(4-5-16(18)20)23(21,22)19-8-2-3-9-19/h4-5,12,14H,2-3,6-11,13H2,1H3/p+1 |
| InChIKey | LYFHHYLGPGMTFA-UHFFFAOYSA-O |
| XLogP | -0.09 |
| TPSA | 63.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.47 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |