C17H24N2O3S2 — CID 141065484
4-[(3-cyclopentyl-3,4-dihydro-2H-1,2-benzothiazin-7-yl)sulfonyl]morpholine (PubChem CID 141065484) has the molecular formula C17H24N2O3S2 and a molecular weight of 368.52 g/mol. Its IUPAC name is 4-[(3-cyclopentyl-3,4-dihydro-2H-1,2-benzothiazin-7-yl)sulfonyl]morpholine.
| Compound Name | 4-[(3-cyclopentyl-3,4-dihydro-2H-1,2-benzothiazin-7-yl)sulfonyl]morpholine |
|---|---|
| PubChem CID | 141065484 |
| Molecular Formula | C17H24N2O3S2 |
| Molecular Weight | 368.52 g/mol |
| Exact Mass | 368.12 |
| IUPAC Name | 4-[(3-cyclopentyl-3,4-dihydro-2H-1,2-benzothiazin-7-yl)sulfonyl]morpholine |
| SMILES | O=S(=O)(c1ccc2c(c1)SNC(C1CCCC1)C2)N1CCOCC1 |
| InChI | InChI=1S/C17H24N2O3S2/c20-24(21,19-7-9-22-10-8-19)15-6-5-14-11-16(13-3-1-2-4-13)18-23-17(14)12-15/h5-6,12-13,16,18H,1-4,7-11H2 |
| InChIKey | YOVUWZTXMSZYHY-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.52 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|