C15H23N3O2S2 — CID 56978369
7-piperidin-1-ylsulfonyl-3-propyl-3,4-dihydro-2H-1,2,4-benzothiadiazine (PubChem CID 56978369) has the molecular formula C15H23N3O2S2 and a molecular weight of 341.50 g/mol. Its IUPAC name is 7-piperidin-1-ylsulfonyl-3-propyl-3,4-dihydro-2H-1,2,4-benzothiadiazine.
| Compound Name | 7-piperidin-1-ylsulfonyl-3-propyl-3,4-dihydro-2H-1,2,4-benzothiadiazine |
|---|---|
| PubChem CID | 56978369 |
| Molecular Formula | C15H23N3O2S2 |
| Molecular Weight | 341.50 g/mol |
| Exact Mass | 341.12 |
| IUPAC Name | 7-piperidin-1-ylsulfonyl-3-propyl-3,4-dihydro-2H-1,2,4-benzothiadiazine |
| SMILES | CCCC1NSc2cc(S(=O)(=O)N3CCCCC3)ccc2N1 |
| InChI | InChI=1S/C15H23N3O2S2/c1-2-6-15-16-13-8-7-12(11-14(13)21-17-15)22(19,20)18-9-4-3-5-10-18/h7-8,11,15-17H,2-6,9-10H2,1H3 |
| InChIKey | GPYSBTAAKHDTTL-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.50 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|