C21H30N4O4S2 — CID 53106058
2-(azepane-1-carbonyl)-6-(4-ethylpiperazin-1-yl)sulfonyl-4H-1,4-benzothiazin-3-one (PubChem CID 53106058) has the molecular formula C21H30N4O4S2 and a molecular weight of 466.63 g/mol. Its IUPAC name is 2-(azepane-1-carbonyl)-6-(4-ethylpiperazin-1-yl)sulfonyl-4H-1,4-benzothiazin-3-one.
| Compound Name | 2-(azepane-1-carbonyl)-6-(4-ethylpiperazin-1-yl)sulfonyl-4H-1,4-benzothiazin-3-one |
|---|---|
| PubChem CID | 53106058 |
| Molecular Formula | C21H30N4O4S2 |
| Molecular Weight | 466.63 g/mol |
| Exact Mass | 466.17 |
| IUPAC Name | 2-(azepane-1-carbonyl)-6-(4-ethylpiperazin-1-yl)sulfonyl-4H-1,4-benzothiazin-3-one |
| SMILES | CCN1CCN(S(=O)(=O)c2ccc3c(c2)NC(=O)C(C(=O)N2CCCCCC2)S3)CC1 |
| InChI | InChI=1S/C21H30N4O4S2/c1-2-23-11-13-25(14-12-23)31(28,29)16-7-8-18-17(15-16)22-20(26)19(30-18)21(27)24-9-5-3-4-6-10-24/h7-8,15,19H,2-6,9-14H2,1H3,(H,22,26) |
| InChIKey | KRSBWHPICTWIKK-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 90.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.63 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|