C22H31N3O4S2 — CID 95085289
(2R)-2-(azepane-1-carbonyl)-N-(4-methylcyclohexyl)-3-oxo-4H-1,4-benzothiazine-6-sulfonamide (PubChem CID 95085289) has the molecular formula C22H31N3O4S2 and a molecular weight of 465.64 g/mol. Its IUPAC name is (2R)-2-(azepane-1-carbonyl)-N-(4-methylcyclohexyl)-3-oxo-4H-1,4-benzothiazine-6-sulfonamide.
| Compound Name | (2R)-2-(azepane-1-carbonyl)-N-(4-methylcyclohexyl)-3-oxo-4H-1,4-benzothiazine-6-sulfonamide |
|---|---|
| PubChem CID | 95085289 |
| Molecular Formula | C22H31N3O4S2 |
| Molecular Weight | 465.64 g/mol |
| Exact Mass | 465.18 |
| IUPAC Name | (2R)-2-(azepane-1-carbonyl)-N-(4-methylcyclohexyl)-3-oxo-4H-1,4-benzothiazine-6-sulfonamide |
| SMILES | CC1CCC(NS(=O)(=O)c2ccc3c(c2)NC(=O)[C@H](C(=O)N2CCCCCC2)S3)CC1 |
| InChI | InChI=1S/C22H31N3O4S2/c1-15-6-8-16(9-7-15)24-31(28,29)17-10-11-19-18(14-17)23-21(26)20(30-19)22(27)25-12-4-2-3-5-13-25/h10-11,14-16,20,24H,2-9,12-13H2,1H3,(H,23,26)/t15?,16?,20-/m1/s1 |
| InChIKey | LODYSIBEYXPZNP-ALLBUHFWSA-N |
| XLogP | 3.36 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.64 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|