C22H24FN3O4S2 — CID 95085099
(2R)-N-(3-fluoro-4-methylphenyl)-2-(4-methylpiperidine-1-carbonyl)-3-oxo-4H-1,4-benzothiazine-6-sulfonamide (PubChem CID 95085099) has the molecular formula C22H24FN3O4S2 and a molecular weight of 477.58 g/mol. Its IUPAC name is (2R)-N-(3-fluoro-4-methylphenyl)-2-(4-methylpiperidine-1-carbonyl)-3-oxo-4H-1,4-benzothiazine-6-sulfonamide.
| Compound Name | (2R)-N-(3-fluoro-4-methylphenyl)-2-(4-methylpiperidine-1-carbonyl)-3-oxo-4H-1,4-benzothiazine-6-sulfonamide |
|---|---|
| PubChem CID | 95085099 |
| Molecular Formula | C22H24FN3O4S2 |
| Molecular Weight | 477.58 g/mol |
| Exact Mass | 477.12 |
| IUPAC Name | (2R)-N-(3-fluoro-4-methylphenyl)-2-(4-methylpiperidine-1-carbonyl)-3-oxo-4H-1,4-benzothiazine-6-sulfonamide |
| SMILES | Cc1ccc(NS(=O)(=O)c2ccc3c(c2)NC(=O)[C@H](C(=O)N2CCC(C)CC2)S3)cc1F |
| InChI | InChI=1S/C22H24FN3O4S2/c1-13-7-9-26(10-8-13)22(28)20-21(27)24-18-12-16(5-6-19(18)31-20)32(29,30)25-15-4-3-14(2)17(23)11-15/h3-6,11-13,20,25H,7-10H2,1-2H3,(H,24,27)/t20-/m1/s1 |
| InChIKey | VRMMKNJLOLAKHT-HXUWFJFHSA-N |
| XLogP | 3.61 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.58 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|