C22H24ClN3O4S2 — CID 95085041
(2R)-N-(4-chloro-2-methylphenyl)-2-(4-methylpiperidine-1-carbonyl)-3-oxo-4H-1,4-benzothiazine-6-sulfonamide (PubChem CID 95085041) has the molecular formula C22H24ClN3O4S2 and a molecular weight of 494.04 g/mol. Its IUPAC name is (2R)-N-(4-chloro-2-methylphenyl)-2-(4-methylpiperidine-1-carbonyl)-3-oxo-4H-1,4-benzothiazine-6-sulfonamide.
| Compound Name | (2R)-N-(4-chloro-2-methylphenyl)-2-(4-methylpiperidine-1-carbonyl)-3-oxo-4H-1,4-benzothiazine-6-sulfonamide |
|---|---|
| PubChem CID | 95085041 |
| Molecular Formula | C22H24ClN3O4S2 |
| Molecular Weight | 494.04 g/mol |
| Exact Mass | 493.09 |
| IUPAC Name | (2R)-N-(4-chloro-2-methylphenyl)-2-(4-methylpiperidine-1-carbonyl)-3-oxo-4H-1,4-benzothiazine-6-sulfonamide |
| SMILES | Cc1cc(Cl)ccc1NS(=O)(=O)c1ccc2c(c1)NC(=O)[C@H](C(=O)N1CCC(C)CC1)S2 |
| InChI | InChI=1S/C22H24ClN3O4S2/c1-13-7-9-26(10-8-13)22(28)20-21(27)24-18-12-16(4-6-19(18)31-20)32(29,30)25-17-5-3-15(23)11-14(17)2/h3-6,11-13,20,25H,7-10H2,1-2H3,(H,24,27)/t20-/m1/s1 |
| InChIKey | OOLSPRHXRHPSBC-HXUWFJFHSA-N |
| XLogP | 4.12 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.04 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|