C19H17F2N3O5S2 — CID 95085149
(2R)-N-(3,4-difluorophenyl)-2-(morpholine-4-carbonyl)-3-oxo-4H-1,4-benzothiazine-6-sulfonamide (PubChem CID 95085149) has the molecular formula C19H17F2N3O5S2 and a molecular weight of 469.49 g/mol. Its IUPAC name is (2R)-N-(3,4-difluorophenyl)-2-(morpholine-4-carbonyl)-3-oxo-4H-1,4-benzothiazine-6-sulfonamide.
| Compound Name | (2R)-N-(3,4-difluorophenyl)-2-(morpholine-4-carbonyl)-3-oxo-4H-1,4-benzothiazine-6-sulfonamide |
|---|---|
| PubChem CID | 95085149 |
| Molecular Formula | C19H17F2N3O5S2 |
| Molecular Weight | 469.49 g/mol |
| Exact Mass | 469.06 |
| IUPAC Name | (2R)-N-(3,4-difluorophenyl)-2-(morpholine-4-carbonyl)-3-oxo-4H-1,4-benzothiazine-6-sulfonamide |
| SMILES | O=C1Nc2cc(S(=O)(=O)Nc3ccc(F)c(F)c3)ccc2S[C@H]1C(=O)N1CCOCC1 |
| InChI | InChI=1S/C19H17F2N3O5S2/c20-13-3-1-11(9-14(13)21)23-31(27,28)12-2-4-16-15(10-12)22-18(25)17(30-16)19(26)24-5-7-29-8-6-24/h1-4,9-10,17,23H,5-8H2,(H,22,25)/t17-/m1/s1 |
| InChIKey | SQMCAJIZSZSGSI-QGZVFWFLSA-N |
| XLogP | 2.04 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.49 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|