C22H25N3O4S3 — CID 53106041
2-(azepane-1-carbonyl)-N-(3-methylsulfanylphenyl)-3-oxo-4H-1,4-benzothiazine-6-sulfonamide (PubChem CID 53106041) has the molecular formula C22H25N3O4S3 and a molecular weight of 491.66 g/mol. Its IUPAC name is 2-(azepane-1-carbonyl)-N-(3-methylsulfanylphenyl)-3-oxo-4H-1,4-benzothiazine-6-sulfonamide.
| Compound Name | 2-(azepane-1-carbonyl)-N-(3-methylsulfanylphenyl)-3-oxo-4H-1,4-benzothiazine-6-sulfonamide |
|---|---|
| PubChem CID | 53106041 |
| Molecular Formula | C22H25N3O4S3 |
| Molecular Weight | 491.66 g/mol |
| Exact Mass | 491.10 |
| IUPAC Name | 2-(azepane-1-carbonyl)-N-(3-methylsulfanylphenyl)-3-oxo-4H-1,4-benzothiazine-6-sulfonamide |
| SMILES | CSc1cccc(NS(=O)(=O)c2ccc3c(c2)NC(=O)C(C(=O)N2CCCCCC2)S3)c1 |
| InChI | InChI=1S/C22H25N3O4S3/c1-30-16-8-6-7-15(13-16)24-32(28,29)17-9-10-19-18(14-17)23-21(26)20(31-19)22(27)25-11-4-2-3-5-12-25/h6-10,13-14,20,24H,2-5,11-12H2,1H3,(H,23,26) |
| InChIKey | UTUNQCWHCHDFAP-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.66 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|