C18H23N3O4S2 — CID 95085247
(2R)-2-(azepane-1-carbonyl)-N-cyclopropyl-3-oxo-4H-1,4-benzothiazine-6-sulfonamide (PubChem CID 95085247) has the molecular formula C18H23N3O4S2 and a molecular weight of 409.53 g/mol. Its IUPAC name is (2R)-2-(azepane-1-carbonyl)-N-cyclopropyl-3-oxo-4H-1,4-benzothiazine-6-sulfonamide.
| Compound Name | (2R)-2-(azepane-1-carbonyl)-N-cyclopropyl-3-oxo-4H-1,4-benzothiazine-6-sulfonamide |
|---|---|
| PubChem CID | 95085247 |
| Molecular Formula | C18H23N3O4S2 |
| Molecular Weight | 409.53 g/mol |
| Exact Mass | 409.11 |
| IUPAC Name | (2R)-2-(azepane-1-carbonyl)-N-cyclopropyl-3-oxo-4H-1,4-benzothiazine-6-sulfonamide |
| SMILES | O=C1Nc2cc(S(=O)(=O)NC3CC3)ccc2S[C@H]1C(=O)N1CCCCCC1 |
| InChI | InChI=1S/C18H23N3O4S2/c22-17-16(18(23)21-9-3-1-2-4-10-21)26-15-8-7-13(11-14(15)19-17)27(24,25)20-12-5-6-12/h7-8,11-12,16,20H,1-6,9-10H2,(H,19,22)/t16-/m1/s1 |
| InChIKey | REFORVYQKYLZQC-MRXNPFEDSA-N |
| XLogP | 1.94 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.53 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|