C18H24N3O3S2+ — CID 9184497
benzyl-methyl-[(5-morpholin-4-ylsulfonyl-2-sulfanylidene-1-pyridinyl)methyl]azanium (PubChem CID 9184497) has the molecular formula C18H24N3O3S2+ and a molecular weight of 394.54 g/mol. Its IUPAC name is benzyl-methyl-[(5-morpholin-4-ylsulfonyl-2-sulfanylidene-1-pyridinyl)methyl]azanium.
| Compound Name | benzyl-methyl-[(5-morpholin-4-ylsulfonyl-2-sulfanylidene-1-pyridinyl)methyl]azanium |
|---|---|
| PubChem CID | 9184497 |
| Molecular Formula | C18H24N3O3S2+ |
| Molecular Weight | 394.54 g/mol |
| Exact Mass | 394.13 |
| IUPAC Name | benzyl-methyl-[(5-morpholin-4-ylsulfonyl-2-sulfanylidene-1-pyridinyl)methyl]azanium |
| SMILES | C[NH+](Cc1ccccc1)Cn1cc(S(=O)(=O)N2CCOCC2)ccc1=S |
| InChI | InChI=1S/C18H23N3O3S2/c1-19(13-16-5-3-2-4-6-16)15-20-14-17(7-8-18(20)25)26(22,23)21-9-11-24-12-10-21/h2-8,14H,9-13,15H2,1H3/p+1 |
| InChIKey | JXHJDJAIJJVOJZ-UHFFFAOYSA-O |
| XLogP | 0.91 |
| TPSA | 55.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.54 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|