C20H27N3O3S2 — CID 9279985
1-[[(2,4-dimethylphenyl)methyl-methylamino]methyl]-5-morpholin-4-ylsulfonylpyridine-2-thione (PubChem CID 9279985) has the molecular formula C20H27N3O3S2 and a molecular weight of 421.59 g/mol. Its IUPAC name is 1-[[(2,4-dimethylphenyl)methyl-methylamino]methyl]-5-morpholin-4-ylsulfonylpyridine-2-thione.
| Compound Name | 1-[[(2,4-dimethylphenyl)methyl-methylamino]methyl]-5-morpholin-4-ylsulfonylpyridine-2-thione |
|---|---|
| PubChem CID | 9279985 |
| Molecular Formula | C20H27N3O3S2 |
| Molecular Weight | 421.59 g/mol |
| Exact Mass | 421.15 |
| IUPAC Name | 1-[[(2,4-dimethylphenyl)methyl-methylamino]methyl]-5-morpholin-4-ylsulfonylpyridine-2-thione |
| SMILES | Cc1ccc(CN(C)Cn2cc(S(=O)(=O)N3CCOCC3)ccc2=S)c(C)c1 |
| InChI | InChI=1S/C20H27N3O3S2/c1-16-4-5-18(17(2)12-16)13-21(3)15-22-14-19(6-7-20(22)27)28(24,25)23-8-10-26-11-9-23/h4-7,12,14H,8-11,13,15H2,1-3H3 |
| InChIKey | DYHGGCRWOYGKBQ-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 54.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.59 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|