C16H17FN2O4S — CID 53170598
1-[(3-fluorophenyl)methyl]-5-morpholin-4-ylsulfonylpyridin-2-one (PubChem CID 53170598) has the molecular formula C16H17FN2O4S and a molecular weight of 352.39 g/mol. Its IUPAC name is 1-[(3-fluorophenyl)methyl]-5-morpholin-4-ylsulfonylpyridin-2-one.
| Compound Name | 1-[(3-fluorophenyl)methyl]-5-morpholin-4-ylsulfonylpyridin-2-one |
|---|---|
| PubChem CID | 53170598 |
| Molecular Formula | C16H17FN2O4S |
| Molecular Weight | 352.39 g/mol |
| Exact Mass | 352.09 |
| IUPAC Name | 1-[(3-fluorophenyl)methyl]-5-morpholin-4-ylsulfonylpyridin-2-one |
| SMILES | O=c1ccc(S(=O)(=O)N2CCOCC2)cn1Cc1cccc(F)c1 |
| InChI | InChI=1S/C16H17FN2O4S/c17-14-3-1-2-13(10-14)11-18-12-15(4-5-16(18)20)24(21,22)19-6-8-23-9-7-19/h1-5,10,12H,6-9,11H2 |
| InChIKey | VECAJAALKJFYOX-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 68.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.39 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |