C17H26N2O3S — CID 18135081
4-[3-[(3-methylpiperidin-1-yl)methyl]phenyl]sulfonylmorpholine (PubChem CID 18135081) has the molecular formula C17H26N2O3S and a molecular weight of 338.47 g/mol. Its IUPAC name is 4-[3-[(3-methylpiperidin-1-yl)methyl]phenyl]sulfonylmorpholine.
| Compound Name | 4-[3-[(3-methylpiperidin-1-yl)methyl]phenyl]sulfonylmorpholine |
|---|---|
| PubChem CID | 18135081 |
| Molecular Formula | C17H26N2O3S |
| Molecular Weight | 338.47 g/mol |
| Exact Mass | 338.17 |
| IUPAC Name | 4-[3-[(3-methylpiperidin-1-yl)methyl]phenyl]sulfonylmorpholine |
| SMILES | CC1CCCN(Cc2cccc(S(=O)(=O)N3CCOCC3)c2)C1 |
| InChI | InChI=1S/C17H26N2O3S/c1-15-4-3-7-18(13-15)14-16-5-2-6-17(12-16)23(20,21)19-8-10-22-11-9-19/h2,5-6,12,15H,3-4,7-11,13-14H2,1H3 |
| InChIKey | PVTGZRRVQHIRTP-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.47 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |