C14H20N2O5S2 — CID 19258973
4-[(1-ethylsulfonyl-2,3-dihydroindol-5-yl)sulfonyl]morpholine (PubChem CID 19258973) has the molecular formula C14H20N2O5S2 and a molecular weight of 360.46 g/mol. Its IUPAC name is 4-[(1-ethylsulfonyl-2,3-dihydroindol-5-yl)sulfonyl]morpholine.
| Compound Name | 4-[(1-ethylsulfonyl-2,3-dihydroindol-5-yl)sulfonyl]morpholine |
|---|---|
| PubChem CID | 19258973 |
| Molecular Formula | C14H20N2O5S2 |
| Molecular Weight | 360.46 g/mol |
| Exact Mass | 360.08 |
| IUPAC Name | 4-[(1-ethylsulfonyl-2,3-dihydroindol-5-yl)sulfonyl]morpholine |
| SMILES | CCS(=O)(=O)N1CCc2cc(S(=O)(=O)N3CCOCC3)ccc21 |
| InChI | InChI=1S/C14H20N2O5S2/c1-2-22(17,18)16-6-5-12-11-13(3-4-14(12)16)23(19,20)15-7-9-21-10-8-15/h3-4,11H,2,5-10H2,1H3 |
| InChIKey | GPSTULICLUPTAG-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.46 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |