C25H26N2O2Si — CID 140848579
1-ethyl-5,5-dimethyl-3-triphenylsilylimidazolidine-2,4-dione (PubChem CID 140848579) has the molecular formula C25H26N2O2Si and a molecular weight of 414.58 g/mol. Its IUPAC name is 1-ethyl-5,5-dimethyl-3-triphenylsilylimidazolidine-2,4-dione.
| Compound Name | 1-ethyl-5,5-dimethyl-3-triphenylsilylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 140848579 |
| Molecular Formula | C25H26N2O2Si |
| Molecular Weight | 414.58 g/mol |
| Exact Mass | 414.18 |
| IUPAC Name | 1-ethyl-5,5-dimethyl-3-triphenylsilylimidazolidine-2,4-dione |
| SMILES | CCN1C(=O)N([Si](c2ccccc2)(c2ccccc2)c2ccccc2)C(=O)C1(C)C |
| InChI | InChI=1S/C25H26N2O2Si/c1-4-26-24(29)27(23(28)25(26,2)3)30(20-14-8-5-9-15-20,21-16-10-6-11-17-21)22-18-12-7-13-19-22/h5-19H,4H2,1-3H3 |
| InChIKey | AUQMXLUMDAQYGH-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.58 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|